Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
1-Hexene, 99%, AcroSeal™
CAS: 592-41-6 Molecular Formula: C6H12 Molecular Weight (g/mol): 84.15 MDL Number: MFCD00009505 InChI Key: LIKMAJRDDDTEIG-UHFFFAOYSA-N Synonym: 1-hexene,hexene,butylethylene,hexylene,hexene-1,1-n-hexene,butyl ethylene,dialene 6,n-hexene,unii-b38zz8c206 PubChem CID: 11597 ChEBI: CHEBI:24579 IUPAC Name: hex-1-ene SMILES: CCCCC=C
| PubChem CID | 11597 |
|---|---|
| CAS | 592-41-6 |
| Molecular Weight (g/mol) | 84.15 |
| ChEBI | CHEBI:24579 |
| MDL Number | MFCD00009505 |
| SMILES | CCCCC=C |
| Synonym | 1-hexene,hexene,butylethylene,hexylene,hexene-1,1-n-hexene,butyl ethylene,dialene 6,n-hexene,unii-b38zz8c206 |
| IUPAC Name | hex-1-ene |
| InChI Key | LIKMAJRDDDTEIG-UHFFFAOYSA-N |
| Molecular Formula | C6H12 |
L(+)-Ornithine hydrochloride, 99%
CAS: 3184-13-2 Molecular Formula: C5H12N2O2·HCl Molecular Weight (g/mol): 168.62 MDL Number: MFCD00064562 InChI Key: GGTYBZJRPHEQDG-WCCKRBBISA-N Synonym: l-ornithine hydrochloride,l-ornithine monohydrochloride,h-orn-oh.hcl,l-ornithine hcl,l +-ornithine hydrochloride,l-ornithine, monohydrochloride,s-2,5-diaminopentanoic acid hydrochloride,ornithine hydrochloride van,unii-hbk84k66xh,ornithine l monochlorohydrate PubChem CID: 76654 IUPAC Name: (2S)-2,5-diaminopentanoic acid;hydrochloride SMILES: C(CC(C(=O)O)N)CN.Cl
| PubChem CID | 76654 |
|---|---|
| CAS | 3184-13-2 |
| Molecular Weight (g/mol) | 168.62 |
| MDL Number | MFCD00064562 |
| SMILES | C(CC(C(=O)O)N)CN.Cl |
| Synonym | l-ornithine hydrochloride,l-ornithine monohydrochloride,h-orn-oh.hcl,l-ornithine hcl,l +-ornithine hydrochloride,l-ornithine, monohydrochloride,s-2,5-diaminopentanoic acid hydrochloride,ornithine hydrochloride van,unii-hbk84k66xh,ornithine l monochlorohydrate |
| IUPAC Name | (2S)-2,5-diaminopentanoic acid;hydrochloride |
| InChI Key | GGTYBZJRPHEQDG-WCCKRBBISA-N |
| Molecular Formula | C5H12N2O2·HCl |
beta-Carotene, 99%
CAS: 7235-40-7 Molecular Formula: C40H56 Molecular Weight (g/mol): 536.89 MDL Number: MFCD00001556 InChI Key: OENHQHLEOONYIE-JLTXGRSLSA-N Synonym: beta-carotene,beta carotene,betacarotene,beta,beta-carotene,provitamin a,solatene,carotaben,provatene,all-trans-beta-carotene,serlabo PubChem CID: 5280489 ChEBI: CHEBI:17579 IUPAC Name: 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene SMILES: C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C
| PubChem CID | 5280489 |
|---|---|
| CAS | 7235-40-7 |
| Molecular Weight (g/mol) | 536.89 |
| ChEBI | CHEBI:17579 |
| MDL Number | MFCD00001556 |
| SMILES | C\C(\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)CCCC1(C)C |
| Synonym | beta-carotene,beta carotene,betacarotene,beta,beta-carotene,provitamin a,solatene,carotaben,provatene,all-trans-beta-carotene,serlabo |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
| InChI Key | OENHQHLEOONYIE-JLTXGRSLSA-N |
| Molecular Formula | C40H56 |
Thermo Scientific Chemicals 2'-Deoxyguanosine-5'-monophosphate disodium salt hydrate, 98%
CAS: 146877-98-7 Molecular Formula: C10H12N5Na2O7P Molecular Weight (g/mol): 391.19 MDL Number: MFCD00080331,MFCD00150758 InChI Key: CTPAMSRBXKGZCJ-UHFFFAOYNA-L Synonym: 2'-Deoxy-5'-guanylic acid disodium salt; 5'-dGMP disodium salt PubChem CID: 123133822 IUPAC Name: [(2R,3S,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;sodium SMILES: [Na+].[Na+].NC1=NC(=O)C2=C(N1)N(C=N2)C1CC(O)C(COP([O-])([O-])=O)O1
| PubChem CID | 123133822 |
|---|---|
| CAS | 146877-98-7 |
| Molecular Weight (g/mol) | 391.19 |
| MDL Number | MFCD00080331,MFCD00150758 |
| SMILES | [Na+].[Na+].NC1=NC(=O)C2=C(N1)N(C=N2)C1CC(O)C(COP([O-])([O-])=O)O1 |
| Synonym | 2'-Deoxy-5'-guanylic acid disodium salt; 5'-dGMP disodium salt |
| IUPAC Name | [(2R,3S,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;sodium |
| InChI Key | CTPAMSRBXKGZCJ-UHFFFAOYNA-L |
| Molecular Formula | C10H12N5Na2O7P |
Bisphenol A, 97+%
CAS: 80-05-7 Molecular Formula: C15H16O2 Molecular Weight (g/mol): 228.29 MDL Number: MFCD00002366 InChI Key: IISBACLAFKSPIT-UHFFFAOYSA-N Synonym: bisphenol a,2,2-bis 4-hydroxyphenyl propane,4,4'-isopropylidenediphenol,diphenylolpropane,bisphenol,diano,4,4'-bisphenol a,4,4'-propane-2,2-diyl diphenol,biphenol a,dian PubChem CID: 6623 ChEBI: CHEBI:33216 IUPAC Name: 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol SMILES: CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1
| PubChem CID | 6623 |
|---|---|
| CAS | 80-05-7 |
| Molecular Weight (g/mol) | 228.29 |
| ChEBI | CHEBI:33216 |
| MDL Number | MFCD00002366 |
| SMILES | CC(C)(C1=CC=C(O)C=C1)C1=CC=C(O)C=C1 |
| Synonym | bisphenol a,2,2-bis 4-hydroxyphenyl propane,4,4'-isopropylidenediphenol,diphenylolpropane,bisphenol,diano,4,4'-bisphenol a,4,4'-propane-2,2-diyl diphenol,biphenol a,dian |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| InChI Key | IISBACLAFKSPIT-UHFFFAOYSA-N |
| Molecular Formula | C15H16O2 |
Ursolic acid, 95%
CAS: 77-52-1 Molecular Formula: C30H48O3 Molecular Weight (g/mol): 456.71 MDL Number: MFCD00009621 InChI Key: WCGUUGGRBIKTOS-GPOJBZKASA-N Synonym: 3beta-Hydroxyurs-12-en-28-oic acid PubChem CID: 129316832 IUPAC Name: (4aS,6aS,6aS,6bR,8aS,12aR,14bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid SMILES: C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2[C@H]1C)C(O)=O
| PubChem CID | 129316832 |
|---|---|
| CAS | 77-52-1 |
| Molecular Weight (g/mol) | 456.71 |
| MDL Number | MFCD00009621 |
| SMILES | C[C@@H]1CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]2[C@H]1C)C(O)=O |
| Synonym | 3beta-Hydroxyurs-12-en-28-oic acid |
| IUPAC Name | (4aS,6aS,6aS,6bR,8aS,12aR,14bR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| InChI Key | WCGUUGGRBIKTOS-GPOJBZKASA-N |
| Molecular Formula | C30H48O3 |
Thermo Scientific Chemicals Guanidine hydrochloride, Molecular Biology Grade
CAS: 50-01-1 Molecular Formula: CH6ClN3 Molecular Weight (g/mol): 95.53 MDL Number: MFCD00013026 InChI Key: PJJJBBJSCAKJQF-UHFFFAOYSA-N Synonym: guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride PubChem CID: 5742 ChEBI: CHEBI:32735 IUPAC Name: guanidine;hydrochloride SMILES: C(=N)(N)N.Cl
| PubChem CID | 5742 |
|---|---|
| CAS | 50-01-1 |
| Molecular Weight (g/mol) | 95.53 |
| ChEBI | CHEBI:32735 |
| MDL Number | MFCD00013026 |
| SMILES | C(=N)(N)N.Cl |
| Synonym | guanidine hydrochloride,guanidinium chloride,guanidine, monohydrochloride,aminoformamidine hydrochloride,aminomethanamidine hydrochloride,guanidine monohydrochloride,guanidine hcl,guanidine chloride,iminourea hydrochloride,carbamidine hydrochloride |
| IUPAC Name | guanidine;hydrochloride |
| InChI Key | PJJJBBJSCAKJQF-UHFFFAOYSA-N |
| Molecular Formula | CH6ClN3 |
Acrylonitrile, 99+%
CAS: 107-13-1 Molecular Formula: C3H3N Molecular Weight (g/mol): 53.06 MDL Number: MFCD00001927 InChI Key: NLHHRLWOUZZQLW-UHFFFAOYSA-N Synonym: acrylonitrile,2-propenenitrile,vinyl cyanide,propenenitrile,cyanoethylene,carbacryl,fumigrain,acritet,acrylon,ventox PubChem CID: 7855 ChEBI: CHEBI:28217 IUPAC Name: prop-2-enenitrile SMILES: C=CC#N
| PubChem CID | 7855 |
|---|---|
| CAS | 107-13-1 |
| Molecular Weight (g/mol) | 53.06 |
| ChEBI | CHEBI:28217 |
| MDL Number | MFCD00001927 |
| SMILES | C=CC#N |
| Synonym | acrylonitrile,2-propenenitrile,vinyl cyanide,propenenitrile,cyanoethylene,carbacryl,fumigrain,acritet,acrylon,ventox |
| IUPAC Name | prop-2-enenitrile |
| InChI Key | NLHHRLWOUZZQLW-UHFFFAOYSA-N |
| Molecular Formula | C3H3N |
Mesityl oxide, 99%, mixture of alpha- and beta-isomers
CAS: 141-79-7 Molecular Formula: C6H10O Molecular Weight (g/mol): 98.14 InChI Key: SHOJXDKTYKFBRD-UHFFFAOYSA-N Synonym: mesityl oxide,4-methyl-3-penten-2-one,3-penten-2-one, 4-methyl,isopropylideneacetone,isobutenyl methyl ketone,methyl isobutenyl ketone,mesityloxid,mesityloxyde,3-isohexen-2-one,isopropylidene acetone PubChem CID: 8858 IUPAC Name: 4-methylpent-3-en-2-one SMILES: CC(=CC(=O)C)C
| PubChem CID | 8858 |
|---|---|
| CAS | 141-79-7 |
| Molecular Weight (g/mol) | 98.14 |
| SMILES | CC(=CC(=O)C)C |
| Synonym | mesityl oxide,4-methyl-3-penten-2-one,3-penten-2-one, 4-methyl,isopropylideneacetone,isobutenyl methyl ketone,methyl isobutenyl ketone,mesityloxid,mesityloxyde,3-isohexen-2-one,isopropylidene acetone |
| IUPAC Name | 4-methylpent-3-en-2-one |
| InChI Key | SHOJXDKTYKFBRD-UHFFFAOYSA-N |
| Molecular Formula | C6H10O |
2,2'-Bipyridine, ACS, 98%
CAS: 366-18-7 Molecular Formula: C10H8N2 Molecular Weight (g/mol): 156.19 MDL Number: MFCD00006212 InChI Key: ROFVEXUMMXZLPA-UHFFFAOYSA-N Synonym: 2,2'-bipyridine,2,2'-dipyridyl,2,2'-bipyridyl,bipyridine,2,2'-dipyridine,2-2-pyridyl pyridine,2,2'-bipyridin,alpha,alpha'-dipyridyl,alpha,alpha'-bipyridyl,2,2-bipyridyl PubChem CID: 1474 ChEBI: CHEBI:30351 SMILES: C1=CC=C(N=C1)C1=CC=CC=N1
| PubChem CID | 1474 |
|---|---|
| CAS | 366-18-7 |
| Molecular Weight (g/mol) | 156.19 |
| ChEBI | CHEBI:30351 |
| MDL Number | MFCD00006212 |
| SMILES | C1=CC=C(N=C1)C1=CC=CC=N1 |
| Synonym | 2,2'-bipyridine,2,2'-dipyridyl,2,2'-bipyridyl,bipyridine,2,2'-dipyridine,2-2-pyridyl pyridine,2,2'-bipyridin,alpha,alpha'-dipyridyl,alpha,alpha'-bipyridyl,2,2-bipyridyl |
| InChI Key | ROFVEXUMMXZLPA-UHFFFAOYSA-N |
| Molecular Formula | C10H8N2 |
N,N-Diisopropylethylamine, 99.5+%, AcroSeal™
CAS: 7087-68-5 Molecular Formula: C8H19N Molecular Weight (g/mol): 129.24 InChI Key: JGFZNNIVVJXRND-UHFFFAOYSA-N Synonym: n,n-diisopropylethylamine,ethyldiisopropylamine,n-ethyldiisopropylamine,diisopropylethylamine,diea,hunig's base,n-ethyl-n-isopropylpropan-2-amine,dipea,2-propanamine, n-ethyl-n-1-methylethyl,1,1'-dimethyltriethylamine PubChem CID: 81531 IUPAC Name: N-ethyl-N-propan-2-ylpropan-2-amine SMILES: CCN(C(C)C)C(C)C
| PubChem CID | 81531 |
|---|---|
| CAS | 7087-68-5 |
| Molecular Weight (g/mol) | 129.24 |
| SMILES | CCN(C(C)C)C(C)C |
| Synonym | n,n-diisopropylethylamine,ethyldiisopropylamine,n-ethyldiisopropylamine,diisopropylethylamine,diea,hunig's base,n-ethyl-n-isopropylpropan-2-amine,dipea,2-propanamine, n-ethyl-n-1-methylethyl,1,1'-dimethyltriethylamine |
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine |
| InChI Key | JGFZNNIVVJXRND-UHFFFAOYSA-N |
| Molecular Formula | C8H19N |
2,5-Bis(5-tert-butyl-2-benzoxazolyl)thiophene, 99%
CAS: 7128-64-5 Molecular Formula: C26H26N2O2S Molecular Weight (g/mol): 430.566 MDL Number: MFCD00005774 InChI Key: AIXZBGVLNVRQSS-UHFFFAOYSA-N Synonym: bbot,2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene,uvitex ob,2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene,bbot 150,2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene,benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl,unii-w7ur9129gp,fluorescent brightener 184,2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole PubChem CID: 292429 IUPAC Name: 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole SMILES: CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C
| PubChem CID | 292429 |
|---|---|
| CAS | 7128-64-5 |
| Molecular Weight (g/mol) | 430.566 |
| MDL Number | MFCD00005774 |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C |
| Synonym | bbot,2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene,uvitex ob,2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene,bbot 150,2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene,benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl,unii-w7ur9129gp,fluorescent brightener 184,2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole |
| IUPAC Name | 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole |
| InChI Key | AIXZBGVLNVRQSS-UHFFFAOYSA-N |
| Molecular Formula | C26H26N2O2S |
4-Nitrophenyl palmitate, 98+%
CAS: 1492-30-4 Molecular Formula: C22H35NO4 Molecular Weight (g/mol): 377.525 MDL Number: MFCD00047732 InChI Key: LVZSQWIWCANHPF-UHFFFAOYSA-N Synonym: 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # PubChem CID: 73891 ChEBI: CHEBI:85645 IUPAC Name: (4-nitrophenyl) hexadecanoate SMILES: CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-]
| PubChem CID | 73891 |
|---|---|
| CAS | 1492-30-4 |
| Molecular Weight (g/mol) | 377.525 |
| ChEBI | CHEBI:85645 |
| MDL Number | MFCD00047732 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
| Synonym | 4-nitrophenyl palmitate,p-nitrophenyl palmitate,hexadecanoic acid 4-nitrophenyl ester,4-nitrophenyl hexadecanoate,hexadecanoic acid, 4-nitrophenyl ester,4-nitrophenylpalmitate,paranitrophenyl palmitate,para-nitrophenyl palmitate,p-nitrophenyl hexadecanoate,4-nitrophenyl palmitate # |
| IUPAC Name | (4-nitrophenyl) hexadecanoate |
| InChI Key | LVZSQWIWCANHPF-UHFFFAOYSA-N |
| Molecular Formula | C22H35NO4 |
4-Nitrophenyl phosphate disodium salt hexahydrate, 96%
CAS: 333338-18-4 Molecular Formula: C6H4NNa2O6P Molecular Weight (g/mol): 263.05 MDL Number: MFCD00007319 InChI Key: VIYFPAMJCJLZKD-UHFFFAOYSA-L Synonym: pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system PubChem CID: 77949 IUPAC Name: disodium;(4-nitrophenyl) phosphate SMILES: [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1
| PubChem CID | 77949 |
|---|---|
| CAS | 333338-18-4 |
| Molecular Weight (g/mol) | 263.05 |
| MDL Number | MFCD00007319 |
| SMILES | [Na+].[Na+].[O-][N+](=O)C1=CC=C(OP([O-])([O-])=O)C=C1 |
| Synonym | pnpp,disodium 4-nitrophenylphosphate,sodium 4-nitrophenyl phosphate,disodium 4-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, disodium salt,disodium p-nitrophenyl phosphate,phosphoric acid, mono 4-nitrophenyl ester, sodium salt 1:2,p-nitrophenyl phosphate,pnpp liquid substrate system |
| IUPAC Name | disodium;(4-nitrophenyl) phosphate |
| InChI Key | VIYFPAMJCJLZKD-UHFFFAOYSA-L |
| Molecular Formula | C6H4NNa2O6P |
Carbon, activated, Norit ROW 0.8mm pellets, steam activated
CAS: 7440-44-0 Molecular Formula: C Molecular Weight (g/mol): 12.011 MDL Number: MFCD00133992 InChI Key: OKTJSMMVPCPJKN-UHFFFAOYSA-N Synonym: graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve PubChem CID: 5462310 ChEBI: CHEBI:27594 IUPAC Name: carbon SMILES: [C]
| PubChem CID | 5462310 |
|---|---|
| CAS | 7440-44-0 |
| Molecular Weight (g/mol) | 12.011 |
| ChEBI | CHEBI:27594 |
| MDL Number | MFCD00133992 |
| SMILES | [C] |
| Synonym | graphite,activated charcoal,norit,mineral,carbon-12,carbono,graphene,acticarbone,anthrasorb,carbosieve |
| IUPAC Name | carbon |
| InChI Key | OKTJSMMVPCPJKN-UHFFFAOYSA-N |
| Molecular Formula | C |